C11H15F2N3O — CID 103249006
2-amino-3-[2-(3,5-difluorophenyl)ethylamino]propanamide (PubChem CID 103249006) has the molecular formula C11H15F2N3O and a molecular weight of 243.26 g/mol. Its IUPAC name is 2-amino-3-[2-(3,5-difluorophenyl)ethylamino]propanamide.
| Compound Name | 2-amino-3-[2-(3,5-difluorophenyl)ethylamino]propanamide |
|---|---|
| PubChem CID | 103249006 |
| Molecular Formula | C11H15F2N3O |
| Molecular Weight | 243.26 g/mol |
| Exact Mass | 243.12 |
| IUPAC Name | 2-amino-3-[2-(3,5-difluorophenyl)ethylamino]propanamide |
| SMILES | NC(=O)C(N)CNCCc1cc(F)cc(F)c1 |
| InChI | InChI=1S/C11H15F2N3O/c12-8-3-7(4-9(13)5-8)1-2-16-6-10(14)11(15)17/h3-5,10,16H,1-2,6,14H2,(H2,15,17) |
| InChIKey | LAQMRQAZNCVQEA-UHFFFAOYSA-N |
| XLogP | -0.09 |
| TPSA | 81.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.26 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|