C12H17FN2O2 — CID 115241834
3-amino-4-[2-(3-fluorophenyl)ethylamino]butanoic acid (PubChem CID 115241834) has the molecular formula C12H17FN2O2 and a molecular weight of 240.28 g/mol. Its IUPAC name is 3-amino-4-[2-(3-fluorophenyl)ethylamino]butanoic acid.
| Compound Name | 3-amino-4-[2-(3-fluorophenyl)ethylamino]butanoic acid |
|---|---|
| PubChem CID | 115241834 |
| Molecular Formula | C12H17FN2O2 |
| Molecular Weight | 240.28 g/mol |
| Exact Mass | 240.13 |
| IUPAC Name | 3-amino-4-[2-(3-fluorophenyl)ethylamino]butanoic acid |
| SMILES | NC(CNCCc1cccc(F)c1)CC(=O)O |
| InChI | InChI=1S/C12H17FN2O2/c13-10-3-1-2-9(6-10)4-5-15-8-11(14)7-12(16)17/h1-3,6,11,15H,4-5,7-8,14H2,(H,16,17) |
| InChIKey | DMYMATHXOORRBD-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.28 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|