C15H22FNO2 — CID 115253437
methyl 2-[[2-(3-fluorophenyl)ethylamino]methyl]-3-methylbutanoate (PubChem CID 115253437) has the molecular formula C15H22FNO2 and a molecular weight of 267.34 g/mol. Its IUPAC name is methyl 2-[[2-(3-fluorophenyl)ethylamino]methyl]-3-methylbutanoate.
| Compound Name | methyl 2-[[2-(3-fluorophenyl)ethylamino]methyl]-3-methylbutanoate |
|---|---|
| PubChem CID | 115253437 |
| Molecular Formula | C15H22FNO2 |
| Molecular Weight | 267.34 g/mol |
| Exact Mass | 267.16 |
| IUPAC Name | methyl 2-[[2-(3-fluorophenyl)ethylamino]methyl]-3-methylbutanoate |
| SMILES | COC(=O)C(CNCCc1cccc(F)c1)C(C)C |
| InChI | InChI=1S/C15H22FNO2/c1-11(2)14(15(18)19-3)10-17-8-7-12-5-4-6-13(16)9-12/h4-6,9,11,14,17H,7-8,10H2,1-3H3 |
| InChIKey | CWSSUIAERBYVFX-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.34 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|