C13H19FN2O3 — CID 108901254
1-(2,2-dimethoxyethyl)-3-[2-(3-fluorophenyl)ethyl]urea (PubChem CID 108901254) has the molecular formula C13H19FN2O3 and a molecular weight of 270.30 g/mol. Its IUPAC name is 1-(2,2-dimethoxyethyl)-3-[2-(3-fluorophenyl)ethyl]urea.
| Compound Name | 1-(2,2-dimethoxyethyl)-3-[2-(3-fluorophenyl)ethyl]urea |
|---|---|
| PubChem CID | 108901254 |
| Molecular Formula | C13H19FN2O3 |
| Molecular Weight | 270.30 g/mol |
| Exact Mass | 270.14 |
| IUPAC Name | 1-(2,2-dimethoxyethyl)-3-[2-(3-fluorophenyl)ethyl]urea |
| SMILES | COC(CNC(=O)NCCc1cccc(F)c1)OC |
| InChI | InChI=1S/C13H19FN2O3/c1-18-12(19-2)9-16-13(17)15-7-6-10-4-3-5-11(14)8-10/h3-5,8,12H,6-7,9H2,1-2H3,(H2,15,16,17) |
| InChIKey | SELHSUABWUVUKT-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.30 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|