C17H19FN2O3 — CID 51290602
1-(3,4-dimethoxyphenyl)-3-[2-(3-fluorophenyl)ethyl]urea (PubChem CID 51290602) has the molecular formula C17H19FN2O3 and a molecular weight of 318.35 g/mol. Its IUPAC name is 1-(3,4-dimethoxyphenyl)-3-[2-(3-fluorophenyl)ethyl]urea.
| Compound Name | 1-(3,4-dimethoxyphenyl)-3-[2-(3-fluorophenyl)ethyl]urea |
|---|---|
| PubChem CID | 51290602 |
| Molecular Formula | C17H19FN2O3 |
| Molecular Weight | 318.35 g/mol |
| Exact Mass | 318.14 |
| IUPAC Name | 1-(3,4-dimethoxyphenyl)-3-[2-(3-fluorophenyl)ethyl]urea |
| SMILES | COc1ccc(NC(=O)NCCc2cccc(F)c2)cc1OC |
| InChI | InChI=1S/C17H19FN2O3/c1-22-15-7-6-14(11-16(15)23-2)20-17(21)19-9-8-12-4-3-5-13(18)10-12/h3-7,10-11H,8-9H2,1-2H3,(H2,19,20,21) |
| InChIKey | CZKAPBNXOSQYGF-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.35 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |