C17H19FN2O3 — CID 86986919
3-(3,4-dimethoxyphenyl)-1-[(3-fluorophenyl)methyl]-1-methylurea (PubChem CID 86986919) has the molecular formula C17H19FN2O3 and a molecular weight of 318.35 g/mol. Its IUPAC name is 3-(3,4-dimethoxyphenyl)-1-[(3-fluorophenyl)methyl]-1-methylurea.
| Compound Name | 3-(3,4-dimethoxyphenyl)-1-[(3-fluorophenyl)methyl]-1-methylurea |
|---|---|
| PubChem CID | 86986919 |
| Molecular Formula | C17H19FN2O3 |
| Molecular Weight | 318.35 g/mol |
| Exact Mass | 318.14 |
| IUPAC Name | 3-(3,4-dimethoxyphenyl)-1-[(3-fluorophenyl)methyl]-1-methylurea |
| SMILES | COc1ccc(NC(=O)N(C)Cc2cccc(F)c2)cc1OC |
| InChI | InChI=1S/C17H19FN2O3/c1-20(11-12-5-4-6-13(18)9-12)17(21)19-14-7-8-15(22-2)16(10-14)23-3/h4-10H,11H2,1-3H3,(H,19,21) |
| InChIKey | SPJAUYWHJWGMBR-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.35 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |