C17H18Cl2N2O3 — CID 55696349
1-[(2,3-dichlorophenyl)methyl]-3-(3,4-dimethoxyphenyl)-1-methylurea (PubChem CID 55696349) has the molecular formula C17H18Cl2N2O3 and a molecular weight of 369.25 g/mol. Its IUPAC name is 1-[(2,3-dichlorophenyl)methyl]-3-(3,4-dimethoxyphenyl)-1-methylurea.
| Compound Name | 1-[(2,3-dichlorophenyl)methyl]-3-(3,4-dimethoxyphenyl)-1-methylurea |
|---|---|
| PubChem CID | 55696349 |
| Molecular Formula | C17H18Cl2N2O3 |
| Molecular Weight | 369.25 g/mol |
| Exact Mass | 368.07 |
| IUPAC Name | 1-[(2,3-dichlorophenyl)methyl]-3-(3,4-dimethoxyphenyl)-1-methylurea |
| SMILES | COc1ccc(NC(=O)N(C)Cc2cccc(Cl)c2Cl)cc1OC |
| InChI | InChI=1S/C17H18Cl2N2O3/c1-21(10-11-5-4-6-13(18)16(11)19)17(22)20-12-7-8-14(23-2)15(9-12)24-3/h4-9H,10H2,1-3H3,(H,20,22) |
| InChIKey | WTSHAJFLBLOFRY-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.25 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |