C9H9Cl2NO2 — CID 23189896
(2,3-dichlorophenyl)methyl-methylcarbamic acid (PubChem CID 23189896) has the molecular formula C9H9Cl2NO2 and a molecular weight of 234.08 g/mol. Its IUPAC name is (2,3-dichlorophenyl)methyl-methylcarbamic acid.
| Compound Name | (2,3-dichlorophenyl)methyl-methylcarbamic acid |
|---|---|
| PubChem CID | 23189896 |
| Molecular Formula | C9H9Cl2NO2 |
| Molecular Weight | 234.08 g/mol |
| Exact Mass | 233.00 |
| IUPAC Name | (2,3-dichlorophenyl)methyl-methylcarbamic acid |
| SMILES | CN(Cc1cccc(Cl)c1Cl)C(=O)O |
| InChI | InChI=1S/C9H9Cl2NO2/c1-12(9(13)14)5-6-3-2-4-7(10)8(6)11/h2-4H,5H2,1H3,(H,13,14) |
| InChIKey | UKVBAZUDUSYBGF-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.08 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |