C18H19Cl2N3O2 — CID 55589948
N-[2-[[(2,3-dichlorophenyl)methyl-methylcarbamoyl]amino]ethyl]benzamide (PubChem CID 55589948) has the molecular formula C18H19Cl2N3O2 and a molecular weight of 380.28 g/mol. Its IUPAC name is N-[2-[[(2,3-dichlorophenyl)methyl-methylcarbamoyl]amino]ethyl]benzamide.
| Compound Name | N-[2-[[(2,3-dichlorophenyl)methyl-methylcarbamoyl]amino]ethyl]benzamide |
|---|---|
| PubChem CID | 55589948 |
| Molecular Formula | C18H19Cl2N3O2 |
| Molecular Weight | 380.28 g/mol |
| Exact Mass | 379.09 |
| IUPAC Name | N-[2-[[(2,3-dichlorophenyl)methyl-methylcarbamoyl]amino]ethyl]benzamide |
| SMILES | CN(Cc1cccc(Cl)c1Cl)C(=O)NCCNC(=O)c1ccccc1 |
| InChI | InChI=1S/C18H19Cl2N3O2/c1-23(12-14-8-5-9-15(19)16(14)20)18(25)22-11-10-21-17(24)13-6-3-2-4-7-13/h2-9H,10-12H2,1H3,(H,21,24)(H,22,25) |
| InChIKey | FRWCUOYUHWSPCU-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.28 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|