C16H16Cl2N2O — CID 60937647
4-(aminomethyl)-N-[(2,3-dichlorophenyl)methyl]-N-methylbenzamide (PubChem CID 60937647) has the molecular formula C16H16Cl2N2O and a molecular weight of 323.22 g/mol. Its IUPAC name is 4-(aminomethyl)-N-[(2,3-dichlorophenyl)methyl]-N-methylbenzamide.
| Compound Name | 4-(aminomethyl)-N-[(2,3-dichlorophenyl)methyl]-N-methylbenzamide |
|---|---|
| PubChem CID | 60937647 |
| Molecular Formula | C16H16Cl2N2O |
| Molecular Weight | 323.22 g/mol |
| Exact Mass | 322.06 |
| IUPAC Name | 4-(aminomethyl)-N-[(2,3-dichlorophenyl)methyl]-N-methylbenzamide |
| SMILES | CN(Cc1cccc(Cl)c1Cl)C(=O)c1ccc(CN)cc1 |
| InChI | InChI=1S/C16H16Cl2N2O/c1-20(10-13-3-2-4-14(17)15(13)18)16(21)12-7-5-11(9-19)6-8-12/h2-8H,9-10,19H2,1H3 |
| InChIKey | JDUBDVXJRLZBMF-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.22 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |