C17H18Cl2N2O4S — CID 27773732
N-[(2,3-dichlorophenyl)methyl]-4-[methoxy(methyl)sulfamoyl]-N-methylbenzamide (PubChem CID 27773732) has the molecular formula C17H18Cl2N2O4S and a molecular weight of 417.31 g/mol. Its IUPAC name is N-[(2,3-dichlorophenyl)methyl]-4-[methoxy(methyl)sulfamoyl]-N-methylbenzamide.
| Compound Name | N-[(2,3-dichlorophenyl)methyl]-4-[methoxy(methyl)sulfamoyl]-N-methylbenzamide |
|---|---|
| PubChem CID | 27773732 |
| Molecular Formula | C17H18Cl2N2O4S |
| Molecular Weight | 417.31 g/mol |
| Exact Mass | 416.04 |
| IUPAC Name | N-[(2,3-dichlorophenyl)methyl]-4-[methoxy(methyl)sulfamoyl]-N-methylbenzamide |
| SMILES | CON(C)S(=O)(=O)c1ccc(C(=O)N(C)Cc2cccc(Cl)c2Cl)cc1 |
| InChI | InChI=1S/C17H18Cl2N2O4S/c1-20(11-13-5-4-6-15(18)16(13)19)17(22)12-7-9-14(10-8-12)26(23,24)21(2)25-3/h4-10H,11H2,1-3H3 |
| InChIKey | XOMVMZXCIFRRGJ-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.31 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|