C16H13Cl2N5O — CID 29415782
N-[(2,3-dichlorophenyl)methyl]-N-methyl-4-(tetrazol-1-yl)benzamide (PubChem CID 29415782) has the molecular formula C16H13Cl2N5O and a molecular weight of 362.22 g/mol. Its IUPAC name is N-[(2,3-dichlorophenyl)methyl]-N-methyl-4-(tetrazol-1-yl)benzamide.
| Compound Name | N-[(2,3-dichlorophenyl)methyl]-N-methyl-4-(tetrazol-1-yl)benzamide |
|---|---|
| PubChem CID | 29415782 |
| Molecular Formula | C16H13Cl2N5O |
| Molecular Weight | 362.22 g/mol |
| Exact Mass | 361.05 |
| IUPAC Name | N-[(2,3-dichlorophenyl)methyl]-N-methyl-4-(tetrazol-1-yl)benzamide |
| SMILES | CN(Cc1cccc(Cl)c1Cl)C(=O)c1ccc(-n2cnnn2)cc1 |
| InChI | InChI=1S/C16H13Cl2N5O/c1-22(9-12-3-2-4-14(17)15(12)18)16(24)11-5-7-13(8-6-11)23-10-19-20-21-23/h2-8,10H,9H2,1H3 |
| InChIKey | YEDHUILTBFMJOQ-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 63.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.22 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |