C25H20ClN7O — CID 29465073
N-[[3-(4-chlorophenyl)-1-phenylpyrazol-4-yl]methyl]-N-methyl-4-(tetrazol-1-yl)benzamide (PubChem CID 29465073) has the molecular formula C25H20ClN7O and a molecular weight of 469.94 g/mol. Its IUPAC name is N-[[3-(4-chlorophenyl)-1-phenylpyrazol-4-yl]methyl]-N-methyl-4-(tetrazol-1-yl)benzamide.
| Compound Name | N-[[3-(4-chlorophenyl)-1-phenylpyrazol-4-yl]methyl]-N-methyl-4-(tetrazol-1-yl)benzamide |
|---|---|
| PubChem CID | 29465073 |
| Molecular Formula | C25H20ClN7O |
| Molecular Weight | 469.94 g/mol |
| Exact Mass | 469.14 |
| IUPAC Name | N-[[3-(4-chlorophenyl)-1-phenylpyrazol-4-yl]methyl]-N-methyl-4-(tetrazol-1-yl)benzamide |
| SMILES | CN(Cc1cn(-c2ccccc2)nc1-c1ccc(Cl)cc1)C(=O)c1ccc(-n2cnnn2)cc1 |
| InChI | InChI=1S/C25H20ClN7O/c1-31(25(34)19-9-13-23(14-10-19)33-17-27-29-30-33)15-20-16-32(22-5-3-2-4-6-22)28-24(20)18-7-11-21(26)12-8-18/h2-14,16-17H,15H2,1H3 |
| InChIKey | NLUBDGZVDIFABP-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 81.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.94 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |