C26H23ClN4O2 — CID 39736620
4-acetamido-N-[[3-(4-chlorophenyl)-1-phenylpyrazol-4-yl]methyl]-N-methylbenzamide (PubChem CID 39736620) has the molecular formula C26H23ClN4O2 and a molecular weight of 458.95 g/mol. Its IUPAC name is 4-acetamido-N-[[3-(4-chlorophenyl)-1-phenylpyrazol-4-yl]methyl]-N-methylbenzamide.
| Compound Name | 4-acetamido-N-[[3-(4-chlorophenyl)-1-phenylpyrazol-4-yl]methyl]-N-methylbenzamide |
|---|---|
| PubChem CID | 39736620 |
| Molecular Formula | C26H23ClN4O2 |
| Molecular Weight | 458.95 g/mol |
| Exact Mass | 458.15 |
| IUPAC Name | 4-acetamido-N-[[3-(4-chlorophenyl)-1-phenylpyrazol-4-yl]methyl]-N-methylbenzamide |
| SMILES | CC(=O)Nc1ccc(C(=O)N(C)Cc2cn(-c3ccccc3)nc2-c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C26H23ClN4O2/c1-18(32)28-23-14-10-20(11-15-23)26(33)30(2)16-21-17-31(24-6-4-3-5-7-24)29-25(21)19-8-12-22(27)13-9-19/h3-15,17H,16H2,1-2H3,(H,28,32) |
| InChIKey | ARKJCFUXFMMALT-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.95 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |