C12H13N5O3 — CID 60988731
3-[methyl-[4-(tetrazol-1-yl)benzoyl]amino]propanoic acid (PubChem CID 60988731) has the molecular formula C12H13N5O3 and a molecular weight of 275.27 g/mol. Its IUPAC name is 3-[methyl-[4-(tetrazol-1-yl)benzoyl]amino]propanoic acid.
| Compound Name | 3-[methyl-[4-(tetrazol-1-yl)benzoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 60988731 |
| Molecular Formula | C12H13N5O3 |
| Molecular Weight | 275.27 g/mol |
| Exact Mass | 275.10 |
| IUPAC Name | 3-[methyl-[4-(tetrazol-1-yl)benzoyl]amino]propanoic acid |
| SMILES | CN(CCC(=O)O)C(=O)c1ccc(-n2cnnn2)cc1 |
| InChI | InChI=1S/C12H13N5O3/c1-16(7-6-11(18)19)12(20)9-2-4-10(5-3-9)17-8-13-14-15-17/h2-5,8H,6-7H2,1H3,(H,18,19) |
| InChIKey | IRZIQKODGIGBNK-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 101.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.27 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |