C13H15N5O4 — CID 120524969
3-[[4-methoxy-3-(tetrazol-1-yl)benzoyl]-methylamino]propanoic acid (PubChem CID 120524969) has the molecular formula C13H15N5O4 and a molecular weight of 305.29 g/mol. Its IUPAC name is 3-[[4-methoxy-3-(tetrazol-1-yl)benzoyl]-methylamino]propanoic acid.
| Compound Name | 3-[[4-methoxy-3-(tetrazol-1-yl)benzoyl]-methylamino]propanoic acid |
|---|---|
| PubChem CID | 120524969 |
| Molecular Formula | C13H15N5O4 |
| Molecular Weight | 305.29 g/mol |
| Exact Mass | 305.11 |
| IUPAC Name | 3-[[4-methoxy-3-(tetrazol-1-yl)benzoyl]-methylamino]propanoic acid |
| SMILES | COc1ccc(C(=O)N(C)CCC(=O)O)cc1-n1cnnn1 |
| InChI | InChI=1S/C13H15N5O4/c1-17(6-5-12(19)20)13(21)9-3-4-11(22-2)10(7-9)18-8-14-15-16-18/h3-4,7-8H,5-6H2,1-2H3,(H,19,20) |
| InChIKey | RSMPSTVVYYZCTM-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 110.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.29 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |