C13H10Cl2INOS — CID 79692774
N-[(2,3-dichlorophenyl)methyl]-5-iodo-N-methylthiophene-3-carboxamide (PubChem CID 79692774) has the molecular formula C13H10Cl2INOS and a molecular weight of 426.11 g/mol. Its IUPAC name is N-[(2,3-dichlorophenyl)methyl]-5-iodo-N-methylthiophene-3-carboxamide.
| Compound Name | N-[(2,3-dichlorophenyl)methyl]-5-iodo-N-methylthiophene-3-carboxamide |
|---|---|
| PubChem CID | 79692774 |
| Molecular Formula | C13H10Cl2INOS |
| Molecular Weight | 426.11 g/mol |
| Exact Mass | 424.89 |
| IUPAC Name | N-[(2,3-dichlorophenyl)methyl]-5-iodo-N-methylthiophene-3-carboxamide |
| SMILES | CN(Cc1cccc(Cl)c1Cl)C(=O)c1csc(I)c1 |
| InChI | InChI=1S/C13H10Cl2INOS/c1-17(13(18)9-5-11(16)19-7-9)6-8-3-2-4-10(14)12(8)15/h2-5,7H,6H2,1H3 |
| InChIKey | ABDPIRSRJPXGNX-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.11 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|