C16H15Cl2N3O2 — CID 47032142
N-[2-[(2,3-dichlorophenyl)carbamoylamino]ethyl]benzamide (PubChem CID 47032142) has the molecular formula C16H15Cl2N3O2 and a molecular weight of 352.22 g/mol. Its IUPAC name is N-[2-[(2,3-dichlorophenyl)carbamoylamino]ethyl]benzamide.
| Compound Name | N-[2-[(2,3-dichlorophenyl)carbamoylamino]ethyl]benzamide |
|---|---|
| PubChem CID | 47032142 |
| Molecular Formula | C16H15Cl2N3O2 |
| Molecular Weight | 352.22 g/mol |
| Exact Mass | 351.05 |
| IUPAC Name | N-[2-[(2,3-dichlorophenyl)carbamoylamino]ethyl]benzamide |
| SMILES | O=C(NCCNC(=O)c1ccccc1)Nc1cccc(Cl)c1Cl |
| InChI | InChI=1S/C16H15Cl2N3O2/c17-12-7-4-8-13(14(12)18)21-16(23)20-10-9-19-15(22)11-5-2-1-3-6-11/h1-8H,9-10H2,(H,19,22)(H2,20,21,23) |
| InChIKey | DDKUFCDGIDGLMP-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.22 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|