C18H20ClN3O3 — CID 55816767
N-[2-[(3-chloro-2-methylphenyl)carbamoylamino]ethyl]-4-methoxybenzamide (PubChem CID 55816767) has the molecular formula C18H20ClN3O3 and a molecular weight of 361.83 g/mol. Its IUPAC name is N-[2-[(3-chloro-2-methylphenyl)carbamoylamino]ethyl]-4-methoxybenzamide.
| Compound Name | N-[2-[(3-chloro-2-methylphenyl)carbamoylamino]ethyl]-4-methoxybenzamide |
|---|---|
| PubChem CID | 55816767 |
| Molecular Formula | C18H20ClN3O3 |
| Molecular Weight | 361.83 g/mol |
| Exact Mass | 361.12 |
| IUPAC Name | N-[2-[(3-chloro-2-methylphenyl)carbamoylamino]ethyl]-4-methoxybenzamide |
| SMILES | COc1ccc(C(=O)NCCNC(=O)Nc2cccc(Cl)c2C)cc1 |
| InChI | InChI=1S/C18H20ClN3O3/c1-12-15(19)4-3-5-16(12)22-18(24)21-11-10-20-17(23)13-6-8-14(25-2)9-7-13/h3-9H,10-11H2,1-2H3,(H,20,23)(H2,21,22,24) |
| InChIKey | KJXUQTBBAJTAKV-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.83 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|