C19H23N3O4 — CID 51118545
4-methoxy-N-[2-[(2-methoxy-5-methylphenyl)carbamoylamino]ethyl]benzamide (PubChem CID 51118545) has the molecular formula C19H23N3O4 and a molecular weight of 357.41 g/mol. Its IUPAC name is 4-methoxy-N-[2-[(2-methoxy-5-methylphenyl)carbamoylamino]ethyl]benzamide.
| Compound Name | 4-methoxy-N-[2-[(2-methoxy-5-methylphenyl)carbamoylamino]ethyl]benzamide |
|---|---|
| PubChem CID | 51118545 |
| Molecular Formula | C19H23N3O4 |
| Molecular Weight | 357.41 g/mol |
| Exact Mass | 357.17 |
| IUPAC Name | 4-methoxy-N-[2-[(2-methoxy-5-methylphenyl)carbamoylamino]ethyl]benzamide |
| SMILES | COc1ccc(C(=O)NCCNC(=O)Nc2cc(C)ccc2OC)cc1 |
| InChI | InChI=1S/C19H23N3O4/c1-13-4-9-17(26-3)16(12-13)22-19(24)21-11-10-20-18(23)14-5-7-15(25-2)8-6-14/h4-9,12H,10-11H2,1-3H3,(H,20,23)(H2,21,22,24) |
| InChIKey | RIPNZRCMUJTTDY-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 88.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.41 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|