C19H21ClN4O4 — CID 56557423
N-[2-[(4-acetamido-2-chlorophenyl)carbamoylamino]ethyl]-4-methoxybenzamide (PubChem CID 56557423) has the molecular formula C19H21ClN4O4 and a molecular weight of 404.85 g/mol. Its IUPAC name is N-[2-[(4-acetamido-2-chlorophenyl)carbamoylamino]ethyl]-4-methoxybenzamide.
| Compound Name | N-[2-[(4-acetamido-2-chlorophenyl)carbamoylamino]ethyl]-4-methoxybenzamide |
|---|---|
| PubChem CID | 56557423 |
| Molecular Formula | C19H21ClN4O4 |
| Molecular Weight | 404.85 g/mol |
| Exact Mass | 404.13 |
| IUPAC Name | N-[2-[(4-acetamido-2-chlorophenyl)carbamoylamino]ethyl]-4-methoxybenzamide |
| SMILES | COc1ccc(C(=O)NCCNC(=O)Nc2ccc(NC(C)=O)cc2Cl)cc1 |
| InChI | InChI=1S/C19H21ClN4O4/c1-12(25)23-14-5-8-17(16(20)11-14)24-19(27)22-10-9-21-18(26)13-3-6-15(28-2)7-4-13/h3-8,11H,9-10H2,1-2H3,(H,21,26)(H,23,25)(H2,22,24,27) |
| InChIKey | NFSYGMCOOUBLSN-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 108.56 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.85 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|