C21H23ClN4O4 — CID 55836968
2-chloro-N-cyclopropyl-5-[2-[(4-methoxybenzoyl)amino]ethylcarbamoylamino]benzamide (PubChem CID 55836968) has the molecular formula C21H23ClN4O4 and a molecular weight of 430.89 g/mol. Its IUPAC name is 2-chloro-N-cyclopropyl-5-[2-[(4-methoxybenzoyl)amino]ethylcarbamoylamino]benzamide.
| Compound Name | 2-chloro-N-cyclopropyl-5-[2-[(4-methoxybenzoyl)amino]ethylcarbamoylamino]benzamide |
|---|---|
| PubChem CID | 55836968 |
| Molecular Formula | C21H23ClN4O4 |
| Molecular Weight | 430.89 g/mol |
| Exact Mass | 430.14 |
| IUPAC Name | 2-chloro-N-cyclopropyl-5-[2-[(4-methoxybenzoyl)amino]ethylcarbamoylamino]benzamide |
| SMILES | COc1ccc(C(=O)NCCNC(=O)Nc2ccc(Cl)c(C(=O)NC3CC3)c2)cc1 |
| InChI | InChI=1S/C21H23ClN4O4/c1-30-16-7-2-13(3-8-16)19(27)23-10-11-24-21(29)26-15-6-9-18(22)17(12-15)20(28)25-14-4-5-14/h2-3,6-9,12,14H,4-5,10-11H2,1H3,(H,23,27)(H,25,28)(H2,24,26,29) |
| InChIKey | IPZNWRBYJTZTHF-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 108.56 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.89 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|