C17H18ClN3O2S — CID 55836455
2-chloro-N-cyclopropyl-5-[(3-methylthiophen-2-yl)methylcarbamoylamino]benzamide (PubChem CID 55836455) has the molecular formula C17H18ClN3O2S and a molecular weight of 363.87 g/mol. Its IUPAC name is 2-chloro-N-cyclopropyl-5-[(3-methylthiophen-2-yl)methylcarbamoylamino]benzamide.
| Compound Name | 2-chloro-N-cyclopropyl-5-[(3-methylthiophen-2-yl)methylcarbamoylamino]benzamide |
|---|---|
| PubChem CID | 55836455 |
| Molecular Formula | C17H18ClN3O2S |
| Molecular Weight | 363.87 g/mol |
| Exact Mass | 363.08 |
| IUPAC Name | 2-chloro-N-cyclopropyl-5-[(3-methylthiophen-2-yl)methylcarbamoylamino]benzamide |
| SMILES | Cc1ccsc1CNC(=O)Nc1ccc(Cl)c(C(=O)NC2CC2)c1 |
| InChI | InChI=1S/C17H18ClN3O2S/c1-10-6-7-24-15(10)9-19-17(23)21-12-4-5-14(18)13(8-12)16(22)20-11-2-3-11/h4-8,11H,2-3,9H2,1H3,(H,20,22)(H2,19,21,23) |
| InChIKey | ZKUSUDORRDUNAW-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.87 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |