C17H16F3N3O3 — CID 51118537
4-methoxy-N-[2-[(2,3,4-trifluorophenyl)carbamoylamino]ethyl]benzamide (PubChem CID 51118537) has the molecular formula C17H16F3N3O3 and a molecular weight of 367.33 g/mol. Its IUPAC name is 4-methoxy-N-[2-[(2,3,4-trifluorophenyl)carbamoylamino]ethyl]benzamide.
| Compound Name | 4-methoxy-N-[2-[(2,3,4-trifluorophenyl)carbamoylamino]ethyl]benzamide |
|---|---|
| PubChem CID | 51118537 |
| Molecular Formula | C17H16F3N3O3 |
| Molecular Weight | 367.33 g/mol |
| Exact Mass | 367.11 |
| IUPAC Name | 4-methoxy-N-[2-[(2,3,4-trifluorophenyl)carbamoylamino]ethyl]benzamide |
| SMILES | COc1ccc(C(=O)NCCNC(=O)Nc2ccc(F)c(F)c2F)cc1 |
| InChI | InChI=1S/C17H16F3N3O3/c1-26-11-4-2-10(3-5-11)16(24)21-8-9-22-17(25)23-13-7-6-12(18)14(19)15(13)20/h2-7H,8-9H2,1H3,(H,21,24)(H2,22,23,25) |
| InChIKey | XWTUIKYOWRASCP-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.33 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|