C19H20F3N3O2 — CID 109046073
1-N-[3-(dimethylamino)propyl]-4-N-(2,3,4-trifluorophenyl)benzene-1,4-dicarboxamide (PubChem CID 109046073) has the molecular formula C19H20F3N3O2 and a molecular weight of 379.38 g/mol. Its IUPAC name is 1-N-[3-(dimethylamino)propyl]-4-N-(2,3,4-trifluorophenyl)benzene-1,4-dicarboxamide.
| Compound Name | 1-N-[3-(dimethylamino)propyl]-4-N-(2,3,4-trifluorophenyl)benzene-1,4-dicarboxamide |
|---|---|
| PubChem CID | 109046073 |
| Molecular Formula | C19H20F3N3O2 |
| Molecular Weight | 379.38 g/mol |
| Exact Mass | 379.15 |
| IUPAC Name | 1-N-[3-(dimethylamino)propyl]-4-N-(2,3,4-trifluorophenyl)benzene-1,4-dicarboxamide |
| SMILES | CN(C)CCCNC(=O)c1ccc(C(=O)Nc2ccc(F)c(F)c2F)cc1 |
| InChI | InChI=1S/C19H20F3N3O2/c1-25(2)11-3-10-23-18(26)12-4-6-13(7-5-12)19(27)24-15-9-8-14(20)16(21)17(15)22/h4-9H,3,10-11H2,1-2H3,(H,23,26)(H,24,27) |
| InChIKey | MZVGRQSXNVGNGV-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.38 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|