C16H18F3N5O — CID 109277899
N-[3-(dimethylamino)propyl]-5-(2,3,4-trifluoroanilino)pyrazine-2-carboxamide (PubChem CID 109277899) has the molecular formula C16H18F3N5O and a molecular weight of 353.35 g/mol. Its IUPAC name is N-[3-(dimethylamino)propyl]-5-(2,3,4-trifluoroanilino)pyrazine-2-carboxamide.
| Compound Name | N-[3-(dimethylamino)propyl]-5-(2,3,4-trifluoroanilino)pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 109277899 |
| Molecular Formula | C16H18F3N5O |
| Molecular Weight | 353.35 g/mol |
| Exact Mass | 353.15 |
| IUPAC Name | N-[3-(dimethylamino)propyl]-5-(2,3,4-trifluoroanilino)pyrazine-2-carboxamide |
| SMILES | CN(C)CCCNC(=O)c1cnc(Nc2ccc(F)c(F)c2F)cn1 |
| InChI | InChI=1S/C16H18F3N5O/c1-24(2)7-3-6-20-16(25)12-8-22-13(9-21-12)23-11-5-4-10(17)14(18)15(11)19/h4-5,8-9H,3,6-7H2,1-2H3,(H,20,25)(H,22,23) |
| InChIKey | QPOAVPXFVXCBLP-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 70.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.35 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|