C16H19F2N5O — CID 109277881
5-(2,4-difluoroanilino)-N-[3-(dimethylamino)propyl]pyrazine-2-carboxamide (PubChem CID 109277881) has the molecular formula C16H19F2N5O and a molecular weight of 335.36 g/mol. Its IUPAC name is 5-(2,4-difluoroanilino)-N-[3-(dimethylamino)propyl]pyrazine-2-carboxamide.
| Compound Name | 5-(2,4-difluoroanilino)-N-[3-(dimethylamino)propyl]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 109277881 |
| Molecular Formula | C16H19F2N5O |
| Molecular Weight | 335.36 g/mol |
| Exact Mass | 335.16 |
| IUPAC Name | 5-(2,4-difluoroanilino)-N-[3-(dimethylamino)propyl]pyrazine-2-carboxamide |
| SMILES | CN(C)CCCNC(=O)c1cnc(Nc2ccc(F)cc2F)cn1 |
| InChI | InChI=1S/C16H19F2N5O/c1-23(2)7-3-6-19-16(24)14-9-21-15(10-20-14)22-13-5-4-11(17)8-12(13)18/h4-5,8-10H,3,6-7H2,1-2H3,(H,19,24)(H,21,22) |
| InChIKey | OBWFTMVHMQLZEV-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 70.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.36 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|