C17H19F3N4O — CID 109289002
N,N-dipropyl-5-(2,3,4-trifluoroanilino)pyrazine-2-carboxamide (PubChem CID 109289002) has the molecular formula C17H19F3N4O and a molecular weight of 352.36 g/mol. Its IUPAC name is N,N-dipropyl-5-(2,3,4-trifluoroanilino)pyrazine-2-carboxamide.
| Compound Name | N,N-dipropyl-5-(2,3,4-trifluoroanilino)pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 109289002 |
| Molecular Formula | C17H19F3N4O |
| Molecular Weight | 352.36 g/mol |
| Exact Mass | 352.15 |
| IUPAC Name | N,N-dipropyl-5-(2,3,4-trifluoroanilino)pyrazine-2-carboxamide |
| SMILES | CCCN(CCC)C(=O)c1cnc(Nc2ccc(F)c(F)c2F)cn1 |
| InChI | InChI=1S/C17H19F3N4O/c1-3-7-24(8-4-2)17(25)13-9-22-14(10-21-13)23-12-6-5-11(18)15(19)16(12)20/h5-6,9-10H,3-4,7-8H2,1-2H3,(H,22,23) |
| InChIKey | XTZDWDDRHIGNFZ-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.36 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|