C17H10F4N4O — CID 109292530
N-(4-fluorophenyl)-5-(2,3,4-trifluoroanilino)pyrazine-2-carboxamide (PubChem CID 109292530) has the molecular formula C17H10F4N4O and a molecular weight of 362.29 g/mol. Its IUPAC name is N-(4-fluorophenyl)-5-(2,3,4-trifluoroanilino)pyrazine-2-carboxamide.
| Compound Name | N-(4-fluorophenyl)-5-(2,3,4-trifluoroanilino)pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 109292530 |
| Molecular Formula | C17H10F4N4O |
| Molecular Weight | 362.29 g/mol |
| Exact Mass | 362.08 |
| IUPAC Name | N-(4-fluorophenyl)-5-(2,3,4-trifluoroanilino)pyrazine-2-carboxamide |
| SMILES | O=C(Nc1ccc(F)cc1)c1cnc(Nc2ccc(F)c(F)c2F)cn1 |
| InChI | InChI=1S/C17H10F4N4O/c18-9-1-3-10(4-2-9)24-17(26)13-7-23-14(8-22-13)25-12-6-5-11(19)15(20)16(12)21/h1-8H,(H,23,25)(H,24,26) |
| InChIKey | WSEGLSLLCDCSOO-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.29 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|