C18H12F4N4O — CID 109292493
N-(4-fluorophenyl)-5-[4-(trifluoromethyl)anilino]pyrazine-2-carboxamide (PubChem CID 109292493) has the molecular formula C18H12F4N4O and a molecular weight of 376.31 g/mol. Its IUPAC name is N-(4-fluorophenyl)-5-[4-(trifluoromethyl)anilino]pyrazine-2-carboxamide.
| Compound Name | N-(4-fluorophenyl)-5-[4-(trifluoromethyl)anilino]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 109292493 |
| Molecular Formula | C18H12F4N4O |
| Molecular Weight | 376.31 g/mol |
| Exact Mass | 376.09 |
| IUPAC Name | N-(4-fluorophenyl)-5-[4-(trifluoromethyl)anilino]pyrazine-2-carboxamide |
| SMILES | O=C(Nc1ccc(F)cc1)c1cnc(Nc2ccc(C(F)(F)F)cc2)cn1 |
| InChI | InChI=1S/C18H12F4N4O/c19-12-3-7-14(8-4-12)26-17(27)15-9-24-16(10-23-15)25-13-5-1-11(2-6-13)18(20,21)22/h1-10H,(H,24,25)(H,26,27) |
| InChIKey | NOSNANKIRHQWRZ-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.31 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |