C19H14F4N4O — CID 109281758
5-[(4-fluorophenyl)methylamino]-N-[4-(trifluoromethyl)phenyl]pyrazine-2-carboxamide (PubChem CID 109281758) has the molecular formula C19H14F4N4O and a molecular weight of 390.34 g/mol. Its IUPAC name is 5-[(4-fluorophenyl)methylamino]-N-[4-(trifluoromethyl)phenyl]pyrazine-2-carboxamide.
| Compound Name | 5-[(4-fluorophenyl)methylamino]-N-[4-(trifluoromethyl)phenyl]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 109281758 |
| Molecular Formula | C19H14F4N4O |
| Molecular Weight | 390.34 g/mol |
| Exact Mass | 390.11 |
| IUPAC Name | 5-[(4-fluorophenyl)methylamino]-N-[4-(trifluoromethyl)phenyl]pyrazine-2-carboxamide |
| SMILES | O=C(Nc1ccc(C(F)(F)F)cc1)c1cnc(NCc2ccc(F)cc2)cn1 |
| InChI | InChI=1S/C19H14F4N4O/c20-14-5-1-12(2-6-14)9-25-17-11-24-16(10-26-17)18(28)27-15-7-3-13(4-8-15)19(21,22)23/h1-8,10-11H,9H2,(H,25,26)(H,27,28) |
| InChIKey | PTUCVCZJHQPAOO-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.34 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |