C15H13F3N4O — CID 109272282
5-(prop-2-enylamino)-N-[4-(trifluoromethyl)phenyl]pyrazine-2-carboxamide (PubChem CID 109272282) has the molecular formula C15H13F3N4O and a molecular weight of 322.29 g/mol. Its IUPAC name is 5-(prop-2-enylamino)-N-[4-(trifluoromethyl)phenyl]pyrazine-2-carboxamide.
| Compound Name | 5-(prop-2-enylamino)-N-[4-(trifluoromethyl)phenyl]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 109272282 |
| Molecular Formula | C15H13F3N4O |
| Molecular Weight | 322.29 g/mol |
| Exact Mass | 322.10 |
| IUPAC Name | 5-(prop-2-enylamino)-N-[4-(trifluoromethyl)phenyl]pyrazine-2-carboxamide |
| SMILES | C=CCNc1cnc(C(=O)Nc2ccc(C(F)(F)F)cc2)cn1 |
| InChI | InChI=1S/C15H13F3N4O/c1-2-7-19-13-9-20-12(8-21-13)14(23)22-11-5-3-10(4-6-11)15(16,17)18/h2-6,8-9H,1,7H2,(H,19,21)(H,22,23) |
| InChIKey | VRBKLCNTDBQIST-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.29 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|