C14H13ClN4O — CID 109272257
N-(3-chlorophenyl)-5-(prop-2-enylamino)pyrazine-2-carboxamide (PubChem CID 109272257) has the molecular formula C14H13ClN4O and a molecular weight of 288.74 g/mol. Its IUPAC name is N-(3-chlorophenyl)-5-(prop-2-enylamino)pyrazine-2-carboxamide.
| Compound Name | N-(3-chlorophenyl)-5-(prop-2-enylamino)pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 109272257 |
| Molecular Formula | C14H13ClN4O |
| Molecular Weight | 288.74 g/mol |
| Exact Mass | 288.08 |
| IUPAC Name | N-(3-chlorophenyl)-5-(prop-2-enylamino)pyrazine-2-carboxamide |
| SMILES | C=CCNc1cnc(C(=O)Nc2cccc(Cl)c2)cn1 |
| InChI | InChI=1S/C14H13ClN4O/c1-2-6-16-13-9-17-12(8-18-13)14(20)19-11-5-3-4-10(15)7-11/h2-5,7-9H,1,6H2,(H,16,18)(H,19,20) |
| InChIKey | IAFBGZFIONLBMI-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.74 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|