C20H17F3N4O — CID 109291498
N-(2-ethylphenyl)-5-[4-(trifluoromethyl)anilino]pyrazine-2-carboxamide (PubChem CID 109291498) has the molecular formula C20H17F3N4O and a molecular weight of 386.38 g/mol. Its IUPAC name is N-(2-ethylphenyl)-5-[4-(trifluoromethyl)anilino]pyrazine-2-carboxamide.
| Compound Name | N-(2-ethylphenyl)-5-[4-(trifluoromethyl)anilino]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 109291498 |
| Molecular Formula | C20H17F3N4O |
| Molecular Weight | 386.38 g/mol |
| Exact Mass | 386.14 |
| IUPAC Name | N-(2-ethylphenyl)-5-[4-(trifluoromethyl)anilino]pyrazine-2-carboxamide |
| SMILES | CCc1ccccc1NC(=O)c1cnc(Nc2ccc(C(F)(F)F)cc2)cn1 |
| InChI | InChI=1S/C20H17F3N4O/c1-2-13-5-3-4-6-16(13)27-19(28)17-11-25-18(12-24-17)26-15-9-7-14(8-10-15)20(21,22)23/h3-12H,2H2,1H3,(H,25,26)(H,27,28) |
| InChIKey | BSVFOAAPAKINLR-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.38 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |