C17H15F3N2O2 — CID 44998950
N'-(2-ethylphenyl)-N-[4-(trifluoromethyl)phenyl]oxamide (PubChem CID 44998950) has the molecular formula C17H15F3N2O2 and a molecular weight of 336.31 g/mol. Its IUPAC name is N'-(2-ethylphenyl)-N-[4-(trifluoromethyl)phenyl]oxamide.
| Compound Name | N'-(2-ethylphenyl)-N-[4-(trifluoromethyl)phenyl]oxamide |
|---|---|
| PubChem CID | 44998950 |
| Molecular Formula | C17H15F3N2O2 |
| Molecular Weight | 336.31 g/mol |
| Exact Mass | 336.11 |
| IUPAC Name | N'-(2-ethylphenyl)-N-[4-(trifluoromethyl)phenyl]oxamide |
| SMILES | CCc1ccccc1NC(=O)C(=O)Nc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C17H15F3N2O2/c1-2-11-5-3-4-6-14(11)22-16(24)15(23)21-13-9-7-12(8-10-13)17(18,19)20/h3-10H,2H2,1H3,(H,21,23)(H,22,24) |
| InChIKey | RYJHROPRQUKJOU-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.31 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|