C22H20F8N2O2 — CID 5203478
N,N'-bis(2-ethylphenyl)-2,2,3,3,4,4,5,5-octafluorohexanediamide (PubChem CID 5203478) has the molecular formula C22H20F8N2O2 and a molecular weight of 496.40 g/mol. Its IUPAC name is N,N'-bis(2-ethylphenyl)-2,2,3,3,4,4,5,5-octafluorohexanediamide.
| Compound Name | N,N'-bis(2-ethylphenyl)-2,2,3,3,4,4,5,5-octafluorohexanediamide |
|---|---|
| PubChem CID | 5203478 |
| Molecular Formula | C22H20F8N2O2 |
| Molecular Weight | 496.40 g/mol |
| Exact Mass | 496.14 |
| IUPAC Name | N,N'-bis(2-ethylphenyl)-2,2,3,3,4,4,5,5-octafluorohexanediamide |
| SMILES | CCc1ccccc1NC(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(=O)Nc1ccccc1CC |
| InChI | InChI=1S/C22H20F8N2O2/c1-3-13-9-5-7-11-15(13)31-17(33)19(23,24)21(27,28)22(29,30)20(25,26)18(34)32-16-12-8-6-10-14(16)4-2/h5-12H,3-4H2,1-2H3,(H,31,33)(H,32,34) |
| InChIKey | KNAPBFKKHWGADC-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.40 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|