C12H9F7N2O2 — CID 167946081
N-(2-acetamidophenyl)-2,2,3,3,4,4,4-heptafluorobutanamide (PubChem CID 167946081) has the molecular formula C12H9F7N2O2 and a molecular weight of 346.20 g/mol. Its IUPAC name is N-(2-acetamidophenyl)-2,2,3,3,4,4,4-heptafluorobutanamide.
| Compound Name | N-(2-acetamidophenyl)-2,2,3,3,4,4,4-heptafluorobutanamide |
|---|---|
| PubChem CID | 167946081 |
| Molecular Formula | C12H9F7N2O2 |
| Molecular Weight | 346.20 g/mol |
| Exact Mass | 346.06 |
| IUPAC Name | N-(2-acetamidophenyl)-2,2,3,3,4,4,4-heptafluorobutanamide |
| SMILES | CC(=O)Nc1ccccc1NC(=O)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C12H9F7N2O2/c1-6(22)20-7-4-2-3-5-8(7)21-9(23)10(13,14)11(15,16)12(17,18)19/h2-5H,1H3,(H,20,22)(H,21,23) |
| InChIKey | COILDRDYJCDBOH-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.20 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|