C10H6F7NO — CID 9556
2,2,3,3,4,4,4-heptafluoro-N-phenylbutanamide (PubChem CID 9556) has the molecular formula C10H6F7NO and a molecular weight of 289.15 g/mol. Its IUPAC name is 2,2,3,3,4,4,4-heptafluoro-N-phenylbutanamide.
| Compound Name | 2,2,3,3,4,4,4-heptafluoro-N-phenylbutanamide |
|---|---|
| PubChem CID | 9556 |
| Molecular Formula | C10H6F7NO |
| Molecular Weight | 289.15 g/mol |
| Exact Mass | 289.03 |
| IUPAC Name | 2,2,3,3,4,4,4-heptafluoro-N-phenylbutanamide |
| SMILES | O=C(Nc1ccccc1)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C10H6F7NO/c11-8(12,9(13,14)10(15,16)17)7(19)18-6-4-2-1-3-5-6/h1-5H,(H,18,19) |
| InChIKey | AFGARRAOIQHNDW-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.15 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|