C11H5F10NO — CID 17071374
2,2,3,3,4,4,4-heptafluoro-N-[4-(trifluoromethyl)phenyl]butanamide (PubChem CID 17071374) has the molecular formula C11H5F10NO and a molecular weight of 357.15 g/mol. Its IUPAC name is 2,2,3,3,4,4,4-heptafluoro-N-[4-(trifluoromethyl)phenyl]butanamide.
| Compound Name | 2,2,3,3,4,4,4-heptafluoro-N-[4-(trifluoromethyl)phenyl]butanamide |
|---|---|
| PubChem CID | 17071374 |
| Molecular Formula | C11H5F10NO |
| Molecular Weight | 357.15 g/mol |
| Exact Mass | 357.02 |
| IUPAC Name | 2,2,3,3,4,4,4-heptafluoro-N-[4-(trifluoromethyl)phenyl]butanamide |
| SMILES | O=C(Nc1ccc(C(F)(F)F)cc1)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C11H5F10NO/c12-8(13,10(17,18)11(19,20)21)7(23)22-6-3-1-5(2-4-6)9(14,15)16/h1-4H,(H,22,23) |
| InChIKey | YGHKLYPAPXYXJL-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.15 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|