About molecular nitrogen;N-[4-(trifluoromethyl)phenyl]acetamide
molecular nitrogen;N-[4-(trifluoromethyl)phenyl]acetamide (PubChem CID 175275825) has the molecular formula C9H8F3N3O
and a molecular weight of 231.18 g/mol. Its IUPAC name is molecular nitrogen;N-[4-(trifluoromethyl)phenyl]acetamide.
Molecular Properties
| Compound Name | molecular nitrogen;N-[4-(trifluoromethyl)phenyl]acetamide |
| PubChem CID | 175275825 |
| Molecular Formula | C9H8F3N3O |
| Molecular Weight | 231.18 g/mol |
| Exact Mass | 231.06 |
| IUPAC Name | molecular nitrogen;N-[4-(trifluoromethyl)phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(C(F)(F)F)cc1.N#N |
| InChI | InChI=1S/C9H8F3NO.N2/c1-6(14)13-8-4-2-7(3-5-8)9(10,11)12;1-2/h2-5H,1H3,(H,13,14); |
| InChIKey | PAQQZCAFVPDHTR-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 76.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.18 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Azo_group', 'substructure': 'N/A'} |
|---|
Analyze molecular nitrogen;N-[4-(trifluoromethyl)phenyl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of molecular nitrogen;N-[4-(trifluoromethyl)phenyl]acetamide?
The IUPAC name of molecular nitrogen;N-[4-(trifluoromethyl)phenyl]acetamide (CID 175275825) is molecular nitrogen;N-[4-(trifluoromethyl)phenyl]acetamide.
What is the SMILES notation for molecular nitrogen;N-[4-(trifluoromethyl)phenyl]acetamide?
The canonical SMILES for molecular nitrogen;N-[4-(trifluoromethyl)phenyl]acetamide is CC(=O)Nc1ccc(C(F)(F)F)cc1.N#N.
What is the InChIKey of molecular nitrogen;N-[4-(trifluoromethyl)phenyl]acetamide?
The InChIKey is PAQQZCAFVPDHTR-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8F3NO.N2/c1-6(14)13-8-4-2-7(3-5-8)9(10,11)12;1-2/h2-5H,1H3,(H,13,14);.
What are the key properties of molecular nitrogen;N-[4-(trifluoromethyl)phenyl]acetamide?
molecular nitrogen;N-[4-(trifluoromethyl)phenyl]acetamide has a molecular weight of 231.18 g/mol, XLogP of 2.69, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for molecular nitrogen;N-[4-(trifluoromethyl)phenyl]acetamide is sourced from PubChem (CID 175275825), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).