C10H10F3NO2 — CID 94685800
(2R)-2-hydroxy-N-[4-(trifluoromethyl)phenyl]propanamide (PubChem CID 94685800) has the molecular formula C10H10F3NO2 and a molecular weight of 233.19 g/mol. Its IUPAC name is (2R)-2-hydroxy-N-[4-(trifluoromethyl)phenyl]propanamide.
| Compound Name | (2R)-2-hydroxy-N-[4-(trifluoromethyl)phenyl]propanamide |
|---|---|
| PubChem CID | 94685800 |
| Molecular Formula | C10H10F3NO2 |
| Molecular Weight | 233.19 g/mol |
| Exact Mass | 233.07 |
| IUPAC Name | (2R)-2-hydroxy-N-[4-(trifluoromethyl)phenyl]propanamide |
| SMILES | C[C@@H](O)C(=O)Nc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C10H10F3NO2/c1-6(15)9(16)14-8-4-2-7(3-5-8)10(11,12)13/h2-6,15H,1H3,(H,14,16)/t6-/m1/s1 |
| InChIKey | DWJSURUDGIXOLD-ZCFIWIBFSA-N |
| XLogP | 2.02 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.19 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |