C12H15F3N2O — CID 17496516
2-(dimethylamino)-N-[4-(trifluoromethyl)phenyl]propanamide (PubChem CID 17496516) has the molecular formula C12H15F3N2O and a molecular weight of 260.26 g/mol. Its IUPAC name is 2-(dimethylamino)-N-[4-(trifluoromethyl)phenyl]propanamide.
| Compound Name | 2-(dimethylamino)-N-[4-(trifluoromethyl)phenyl]propanamide |
|---|---|
| PubChem CID | 17496516 |
| Molecular Formula | C12H15F3N2O |
| Molecular Weight | 260.26 g/mol |
| Exact Mass | 260.11 |
| IUPAC Name | 2-(dimethylamino)-N-[4-(trifluoromethyl)phenyl]propanamide |
| SMILES | CC(C(=O)Nc1ccc(C(F)(F)F)cc1)N(C)C |
| InChI | InChI=1S/C12H15F3N2O/c1-8(17(2)3)11(18)16-10-6-4-9(5-7-10)12(13,14)15/h4-8H,1-3H3,(H,16,18) |
| InChIKey | CUNANKWONJPLCB-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.26 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |