C12H9F3N2O2 — CID 155903757
(2R)-2-cyano-3-oxo-N-[4-(trifluoromethyl)phenyl]butanamide (PubChem CID 155903757) has the molecular formula C12H9F3N2O2 and a molecular weight of 270.21 g/mol. Its IUPAC name is (2R)-2-cyano-3-oxo-N-[4-(trifluoromethyl)phenyl]butanamide.
| Compound Name | (2R)-2-cyano-3-oxo-N-[4-(trifluoromethyl)phenyl]butanamide |
|---|---|
| PubChem CID | 155903757 |
| Molecular Formula | C12H9F3N2O2 |
| Molecular Weight | 270.21 g/mol |
| Exact Mass | 270.06 |
| IUPAC Name | (2R)-2-cyano-3-oxo-N-[4-(trifluoromethyl)phenyl]butanamide |
| SMILES | CC(=O)[C@@H](C#N)C(=O)Nc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C12H9F3N2O2/c1-7(18)10(6-16)11(19)17-9-4-2-8(3-5-9)12(13,14)15/h2-5,10H,1H3,(H,17,19)/t10-/m1/s1 |
| InChIKey | NABQBYDEMLGCEO-SNVBAGLBSA-N |
| XLogP | 2.37 |
| TPSA | 69.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.21 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|