C18H10F3N3O2S — CID 15181312
[4-[[2-cyano-3-oxo-3-[4-(trifluoromethyl)phenyl]propanoyl]amino]phenyl] thiocyanate (PubChem CID 15181312) has the molecular formula C18H10F3N3O2S and a molecular weight of 389.36 g/mol. Its IUPAC name is [4-[[2-cyano-3-oxo-3-[4-(trifluoromethyl)phenyl]propanoyl]amino]phenyl] thiocyanate.
| Compound Name | [4-[[2-cyano-3-oxo-3-[4-(trifluoromethyl)phenyl]propanoyl]amino]phenyl] thiocyanate |
|---|---|
| PubChem CID | 15181312 |
| Molecular Formula | C18H10F3N3O2S |
| Molecular Weight | 389.36 g/mol |
| Exact Mass | 389.04 |
| IUPAC Name | [4-[[2-cyano-3-oxo-3-[4-(trifluoromethyl)phenyl]propanoyl]amino]phenyl] thiocyanate |
| SMILES | N#CSc1ccc(NC(=O)C(C#N)C(=O)c2ccc(C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C18H10F3N3O2S/c19-18(20,21)12-3-1-11(2-4-12)16(25)15(9-22)17(26)24-13-5-7-14(8-6-13)27-10-23/h1-8,15H,(H,24,26) |
| InChIKey | HBTOJXOJJLPUGE-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 93.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.36 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|