C15H15F3N2O3 — CID 47052858
2-cyano-N-(3-methoxypropyl)-3-oxo-3-[4-(trifluoromethyl)phenyl]propanamide (PubChem CID 47052858) has the molecular formula C15H15F3N2O3 and a molecular weight of 328.29 g/mol. Its IUPAC name is 2-cyano-N-(3-methoxypropyl)-3-oxo-3-[4-(trifluoromethyl)phenyl]propanamide.
| Compound Name | 2-cyano-N-(3-methoxypropyl)-3-oxo-3-[4-(trifluoromethyl)phenyl]propanamide |
|---|---|
| PubChem CID | 47052858 |
| Molecular Formula | C15H15F3N2O3 |
| Molecular Weight | 328.29 g/mol |
| Exact Mass | 328.10 |
| IUPAC Name | 2-cyano-N-(3-methoxypropyl)-3-oxo-3-[4-(trifluoromethyl)phenyl]propanamide |
| SMILES | COCCCNC(=O)C(C#N)C(=O)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C15H15F3N2O3/c1-23-8-2-7-20-14(22)12(9-19)13(21)10-3-5-11(6-4-10)15(16,17)18/h3-6,12H,2,7-8H2,1H3,(H,20,22) |
| InChIKey | ZHRGOPVAKGYQCX-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 79.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.29 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|