C16H16N2O3S — CID 98449767
(2R)-3-(1-benzothiophen-2-yl)-2-cyano-N-(3-methoxypropyl)-3-oxopropanamide (PubChem CID 98449767) has the molecular formula C16H16N2O3S and a molecular weight of 316.38 g/mol. Its IUPAC name is (2R)-3-(1-benzothiophen-2-yl)-2-cyano-N-(3-methoxypropyl)-3-oxopropanamide.
| Compound Name | (2R)-3-(1-benzothiophen-2-yl)-2-cyano-N-(3-methoxypropyl)-3-oxopropanamide |
|---|---|
| PubChem CID | 98449767 |
| Molecular Formula | C16H16N2O3S |
| Molecular Weight | 316.38 g/mol |
| Exact Mass | 316.09 |
| IUPAC Name | (2R)-3-(1-benzothiophen-2-yl)-2-cyano-N-(3-methoxypropyl)-3-oxopropanamide |
| SMILES | COCCCNC(=O)[C@H](C#N)C(=O)c1cc2ccccc2s1 |
| InChI | InChI=1S/C16H16N2O3S/c1-21-8-4-7-18-16(20)12(10-17)15(19)14-9-11-5-2-3-6-13(11)22-14/h2-3,5-6,9,12H,4,7-8H2,1H3,(H,18,20)/t12-/m1/s1 |
| InChIKey | PLGJAVLZUAISPY-GFCCVEGCSA-N |
| XLogP | 2.38 |
| TPSA | 79.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.38 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|