C19H18N2O4S — CID 87108183
N-[3-[4-(hydroxycarbamoyl)phenoxy]propyl]-1-benzothiophene-2-carboxamide (PubChem CID 87108183) has the molecular formula C19H18N2O4S and a molecular weight of 370.43 g/mol. Its IUPAC name is N-[3-[4-(hydroxycarbamoyl)phenoxy]propyl]-1-benzothiophene-2-carboxamide.
| Compound Name | N-[3-[4-(hydroxycarbamoyl)phenoxy]propyl]-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 87108183 |
| Molecular Formula | C19H18N2O4S |
| Molecular Weight | 370.43 g/mol |
| Exact Mass | 370.10 |
| IUPAC Name | N-[3-[4-(hydroxycarbamoyl)phenoxy]propyl]-1-benzothiophene-2-carboxamide |
| SMILES | O=C(NO)c1ccc(OCCCNC(=O)c2cc3ccccc3s2)cc1 |
| InChI | InChI=1S/C19H18N2O4S/c22-18(21-24)13-6-8-15(9-7-13)25-11-3-10-20-19(23)17-12-14-4-1-2-5-16(14)26-17/h1-2,4-9,12,24H,3,10-11H2,(H,20,23)(H,21,22) |
| InChIKey | FBVVIOAKCVUDAH-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.43 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|