C14H14N4OS — CID 64519148
N-[3-(1H-1,2,4-triazol-5-yl)propyl]-1-benzothiophene-2-carboxamide (PubChem CID 64519148) has the molecular formula C14H14N4OS and a molecular weight of 286.36 g/mol. Its IUPAC name is N-[3-(1H-1,2,4-triazol-5-yl)propyl]-1-benzothiophene-2-carboxamide.
| Compound Name | N-[3-(1H-1,2,4-triazol-5-yl)propyl]-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 64519148 |
| Molecular Formula | C14H14N4OS |
| Molecular Weight | 286.36 g/mol |
| Exact Mass | 286.09 |
| IUPAC Name | N-[3-(1H-1,2,4-triazol-5-yl)propyl]-1-benzothiophene-2-carboxamide |
| SMILES | O=C(NCCCc1ncn[nH]1)c1cc2ccccc2s1 |
| InChI | InChI=1S/C14H14N4OS/c19-14(15-7-3-6-13-16-9-17-18-13)12-8-10-4-1-2-5-11(10)20-12/h1-2,4-5,8-9H,3,6-7H2,(H,15,19)(H,16,17,18) |
| InChIKey | HITUQZZGHVIDSH-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.36 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|