C12H12Cl2N4O — CID 64547641
3,4-dichloro-N-[3-(1H-1,2,4-triazol-5-yl)propyl]benzamide (PubChem CID 64547641) has the molecular formula C12H12Cl2N4O and a molecular weight of 299.16 g/mol. Its IUPAC name is 3,4-dichloro-N-[3-(1H-1,2,4-triazol-5-yl)propyl]benzamide.
| Compound Name | 3,4-dichloro-N-[3-(1H-1,2,4-triazol-5-yl)propyl]benzamide |
|---|---|
| PubChem CID | 64547641 |
| Molecular Formula | C12H12Cl2N4O |
| Molecular Weight | 299.16 g/mol |
| Exact Mass | 298.04 |
| IUPAC Name | 3,4-dichloro-N-[3-(1H-1,2,4-triazol-5-yl)propyl]benzamide |
| SMILES | O=C(NCCCc1ncn[nH]1)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C12H12Cl2N4O/c13-9-4-3-8(6-10(9)14)12(19)15-5-1-2-11-16-7-17-18-11/h3-4,6-7H,1-2,5H2,(H,15,19)(H,16,17,18) |
| InChIKey | HTEVRPOTVGOBPO-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.16 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|