C10H12N4O2 — CID 64546872
N-[3-(1H-1,2,4-triazol-5-yl)propyl]furan-3-carboxamide (PubChem CID 64546872) has the molecular formula C10H12N4O2 and a molecular weight of 220.23 g/mol. Its IUPAC name is N-[3-(1H-1,2,4-triazol-5-yl)propyl]furan-3-carboxamide.
| Compound Name | N-[3-(1H-1,2,4-triazol-5-yl)propyl]furan-3-carboxamide |
|---|---|
| PubChem CID | 64546872 |
| Molecular Formula | C10H12N4O2 |
| Molecular Weight | 220.23 g/mol |
| Exact Mass | 220.10 |
| IUPAC Name | N-[3-(1H-1,2,4-triazol-5-yl)propyl]furan-3-carboxamide |
| SMILES | O=C(NCCCc1ncn[nH]1)c1ccoc1 |
| InChI | InChI=1S/C10H12N4O2/c15-10(8-3-5-16-6-8)11-4-1-2-9-12-7-13-14-9/h3,5-7H,1-2,4H2,(H,11,15)(H,12,13,14) |
| InChIKey | NRABNBAYGPDIRP-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 83.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.23 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|